MATTER AND ITS CHANGES

Subject : Chemistry
Program : SBI
State : SMA 5 Surabaya
Class :X
Semester :I
School Year : 2007/2008

Choose the correct answer 6. In a chemical reaction, element A combines with

element B to form compound C. Which of the following
1. Which one of the following is not a pure substance? is not true of compound C?
A. Water. A. It has different properties from element A and
B. Carbon monoxide. element B.
C. Oxygen. B. The ratio by mass of el;ement A to element B
D. Soft drink. is fixed.
C. It is easy to recover element A and element B
2. Which one of the substances below is a compound? from compound C.
A. Gold. D. It made up of more than one element.
B. Hydrogen.
C. Tin. 7. Which one of the following substances is made up
D. Water. more than two elemnts?
A. Water.
3. Mr. Ahmad, a diamond craftsman, cuts a 0.5 carat B. Carbon dioxide.
diamond into smaller stones of 0.35 carat and 0.15 C. Sodium chloride.
carat. Mr. Tan, a rag-and-bone man, tears up a piece of D. Sugar.
newspaper into two halves. Mr Smith, a mountaineer,
burn a nylon rope into two lengths. Which of the 8. Which one of diagrams below represents a diatomic
following statements is true? element ?
A. Mr Ahmad has formed two new elements.
B. Mr Smith has produced new compounds.
C. Mr Tan has created a mixture of elements.
D. All three men have made mixtures of
compounds. A B C D

4.Mary says that soup is a mixture. Which of the
following statements cannot be used to justify her claim?
A. Soup is made up of many different elements.
B. You can add any number of ingredients to a
soup.
C. You can vary the amount of any ingridient in the
soup.
D. It is easy to pick out the ingridients from the
soup.
9. Which of the following statements incorrectly
describes substances around us?
A. Stainless steel is not a compound because the
presentages of chromium and carbon vary.
B. Diamond is a form of the elemnt carbon.
C. Water is a compound because it has a fixed
ratio of hydrogen atoms to oxygen atoms.
D. Sugar is an element because it is made from
the juice of sugar cane only.

5. Which one of the diagrams below shows a mixture of 10. In cooking, many spices and condiments are
compounds? added to flavour a dish. When a dish tastes salty,
gugar is sometimes added to counter the taste. Which
of the following statement best explains the result?
A. Sugar neutralises salt to form a new
compound.
B. Sugar prevents the action of salt.
A B C D
C. Sugar breaks down salt to a new substances.
D. Sugar and salt both give their own taste so the
salty is not so distict.
Write your answer clearly

1. Look at the list of substances below

Silver ingot Diamond Water vapour Helium Ice Plastics

Soap powder Spring water Mercury Chlorophyll Coffee Glass
Ink Soya sauce Sugar Soft drink Milk Iron

Classify them as elemnts, compounds or mixtures by writing the name each substance.

2. Is a salt solution a compound or a mixture? Explain your answer fully using all the properties
of a mixture or compound.

3. Compare a compound and a mixture, listing one similarity and three differences.

4. Compare a chemical changes and physical changes, and give the example of chemical and
physical changes.
TEST 2
ATOMIC STRUCTURE

Choose the correct answer

1. Which the following statements about an atom is correct

a. An atom is negatively charged
b. An atom is neutral
c. An atom is positively charged
d. An atom has a variable charged

2. The number of protons in an atom is equal to the number of

a. neutrons
b. electrons
c. electrons + neutrons
d. neutrons + electrons

3. The smallest particle in an atom is the

a. electron
b. neutron
c. proton
d. electron shell

40
4. An element in the periodic table is represented as 18 Ar Which one of the following statements is
wrong?
a. There are 18 electrons in an atom of the element
b. There are 22 protons in an atom of the element
c. The number of neutrons is greater than the number of electrons
d. There are two electrons in the first shell of the atom

5. Which one of the following symbols correctly represents the atom in the diagram below ?

10
a. 9 F
19
b. 10 F
19
c. 9 F
19
d. 7 F

6. Which one of the following statements is not true about the nucleus of an atom ?
a. It is located at the centre of the atom
b. Its relative mass is nucleon number
c. It always has an equal number of protons and neutrons
d. The mass of an atom is concentrated in the nucleus

7. The electronics structure of an atom X is shown below. How many protons does it have?
a. Two
b. Five
c. Seven
d. Cannot be determined

8. How many valency electrons does the atom Y have

a. Two
b. Three
c. Ten
d. Thirteen

23
9. An element W is listed in the Periodic table as 11
W. Which of the following statements is not true about
W?
a. It has only one valency electron
b. It has an atomic mass of 23
c. It has 11 protons
d. It has fewer neutrons than electrons

20
10. Neon is represented as 10 Ne in the periodic table. Which one of the following best represents its
electronic structure?
a. 2.8
b. 2.8.2
c. 2.8.8
d. 2.8.8.2

Write Your answer

11. How many protons, neutrons, and electrons in each element :
131 109 36
56 Ba , 48 Cd2+ , 17 Cl-

12. Silver has two isotopes, 107Ag with atomic mass 106.9041 and 109Ag with the atomic mass 108.9047. The
relative atomic mass of silver is 107.868. How much the presentage each isotope of silver?

13. Explain about theory of atom (1 theory) !

14. Knowing the atomic number for A , B, C, D, E, F, G, as the following 3, 7, 9, 12, 17, 19, 20.

a. Write the electronic configuration and what does group and period of each element !
b. Arrange the following element by increase radius.
c. Which one of the following element as the smallest electronegativity, the biggest afinity, and the largest
ionisation energy ?

5. 7.

8.

ATOMIC STRUCTURE
Subject : Chemistry
 Program : SBI
State : SMA 5 Surabaya
Class :X
Semester :I
School Year : 2007/2008

1. Complete the following table :

Symbol Atomic Mass Number of Number of Number of Electron

number number protons electrons neutrons configuration
90
Sr 38
11 12
82 35

2. Complete each line in table. There are only two naturally occuring isotopes of each element.

No Isotope A Isotope B Atomic

Isotope percent Mass(u) Isotope percent Mass(u) weight (u)
191 193
1 Ir 37.30 190.9609 Ir 62.70 192.9633 _______
121 123
2 Sb 57.25 _______ Sb 42.75 122.9041 121.75
107 109
3 Ag 51.82 106.9041 Ag 48.18 ________ 107.868
79 81
4 Br _________ 78.9183 Br _______ 80.9163 79.904
12 13
5 C 98.89 _______ C 1.11 ________ 12.011

3. Write the electronic configuration and what does group, period and name of each element?
a. Z = 14 A = 28
b. Z = 56 A = 137
c. Z = 82 A = 207

IONIC AND COVALENT BONDING

Subject : Chemistry
Program : SBI
State : SMA 5 Surabaya
 Class :X
Semester :I
School Year : 2007/2008

1. Complete this sentences :

a. Bonds between nonmetal atoms are………………..
b. Bonds between a metal and a nonmetal atoms are……………………

2. Explain about :
a. Coordinate covalent bonds
b. Polar covalent bonds
c. Nonpolar covalent bond

3.Write structrural formulas and draw electron dot diagram for :

a. CCl4
b. I2
c.SO2
d. BF3
e. MgCl2 (just electron dot diagram)
f. SF6

4. In which of the following compound is bonding essentially ionic, or covalent polar, or

covalent nonpolar ?
a. PCl3
b. CO2
c. HF
d. NaBr
e. F2

CHEMICAL REACTION
Subject : Chemistry
Program : SBI
 State : SMA 5 Surabaya
Class :X
Semester :I
School Year : 2007/2008

1. Sodium solid + Chlorine gas

2. Magnesium (solid) + Oxygen (gas)
3. Pottasium (solid) + Water
4. Pentane gas (C5H12) + Oxygen (gas)
5. Hydrochlorous acid + Sodium Hydroxide
6. Phosphoric acid + Ammonium hydroxide
7. Pottasiumchloride + Ferrous sulfate
8. sodium bicarbonate + Hydrochlorous acid
9. ammonium chloride + lead sulfate
10. copper (II) cyanide + Pottasium hydroxide

ELECTROLYTE AND NON ELECTROLYTE & REDOX

Subject : Chemistry
Program : SBI
State : SMA 5 Surabaya
Class :X
 Semester :I
School Year : 2007/2008

1. Look at the list substances in the box

Table salt (s) Water (l) glucose (aq) CaCl2(aq) Dry ice (s)
acetic acid (aq) Iron (s) ammonia (aq) Hydrochloric acid (aq) Sulfuric acid(aq)

Classify them as
a. Conductor / non conductor
b. Strong electrolyte, weak electrolyte and non electrolyte (explain why)
c. Type of chemical bonding

2. Explain clearly about :

a. solvation
b.. polarization

3. Write down molecular equation and ionic equation, if this reageant are mixed:
a. Sodium Carbonate + Chloric Acid
b. Sodium Nitrite + Sulfuric Acid
c. Ammonium Sulfide + Potassium Hydroxide
d. Iron (III) Chloride + Potassium Hydroxide

4. Assign the oxidation number

a. H in KOH and MgH2
b. Cu in CuSO4.5H2O and Cu(NH3)42+
c. N in NH3 and NH4OH

5. Balance the redox equation (half reaction or oxidation number) and determine
oxidising agent (oxidant) and reducing agent (reductant)
a. Cu + HNO3  Cu(NO3)2 + H2O + NO
b. HI + H2SO4  H2O + H2S + I2
c. SO32- + CrO32-  SO42- + Cr(OH)3 (in basic solution)
d. Cr2(SO4)3 + KNO3 + K2CO3  K2SO4 + K2CrO4 + KNO2 + CO2

OXIDATION - REDUCTION
Subject : Chemistry
Program : SBI
State : SMA 5 Surabaya
Class :X
Semester : II
 School Year : 2007/2008

1. Determine the oxidation number of

a. The chlorine atom in each of the following: HClO 4 (perchloric acid) and ClO3-
(chlorate ion).
b. The chrom atom in each of the following : Cr2O72- and Cr(OH)3
c. The Copper atom in each of the following : CuSO4.5H2O and Cu(NH3)42-

2. Balance the following equation :

a. NO3-(aq) + H2S(g) HSO4- (aq) + NH4+ (aq) (acidic solution)
b. Br2(g) + Zn2+ (aq)  BrO3-(aq) +Zn (s) (basic solution)
c. KMnO4(aq) +H2SO4(aq) + FeSO4 (aq)  K2SO4 (aq) + MnSO4 (aq) + Fe2(SO4)3 (aq) +
H2O (l)
d. Cl2 (g) + OH- (aq)  ClO3- (aq) +Cl- (aq) (basic solution)

3. From the equation No. 2 , determine the compound/ ion which are oxidized, reduced,
oxidazing agent (oxidant), reducing agent (reductant), oxidation product, reduction
product, and which the following equation are disproposionation or autoredox?

OXIDATION - REDUCTION
Subject : Chemistry
Program : SBI
State : SMA 5 Surabaya
Class :X
Semester : II
 School Year : 2007/2008

Choose the best answer !

1.What is the oxidation number of the bromine atom in the complex Ba[BrF4]2 ?
A. -3 C. +1
B. -1 D. +3
2. How many elektrons are required to complete the half-equation
XO4- + 8H+ + …… e ------- X- + 4H2O ?
A. 4 C. 6
B. 5 D. 8
3. The symbol for the element cerium is Ce. The formula of cerium (IV)oxide is …….
A. Ce4O C. CeO
B. Ce2O D. CeO2
4. In Wich one of the following complex ions does the metal atom have oxidation number
of zero ?
A. [Co(CN)4]4- C. [Ni(CN)5]3-
2+
B. [Fe(SCN)(H2O)5] D. [Ni(NH)3]2+
5. In wich one of the following particles does nitrogen have the highest oxidation number
?
A. Li3N C. NH4+
B. N2O D. NO3-
6. In wich one of the following does iodine have oxidation number of +1 ?
A. NaIO4 C. IO3-
-
B. I3 D. OI-
7. Redox based on the hand over and acceptance Cr2O3 + 2 Al ---- Al2O3 + 2Cr
Which actsas the electron surrender is …
A. Cr in Cr2O3 D. Cr
B. Al E. O2 in Cr2O3
C. Al in Al2O3
8. From the reaction in number 7 which actsas the electron receiver is …
A. Cr in Cr2O3 D. Cr
B. Al E. O2 in Cr2O3
C. Al in Al2O3
9. From the reaction in number 7 which actsas the reductor is …
A. Cr in Cr2O3 D. Cr
B. Al E. O2 in Cr2O3
C. Al in Al2O3
10.According to the over and acceptance electron principle, natrium in this reaction
below :
Na + H2O ------- NaOH + H2
Which experiment oxydation’s reaction is caused ….
A. It releases 1 electron so it contains +1
B. It catchs 1 electron so it contains -1
C. It can oxydate water
D. It can cause water be lost its 1 electron
E. It can cause water be over its 1 electron.
11.In the reaction : Cl2 + 2e ------ 2 Cl- is belong to …… reaction
 A. Redox D. Auto redox
B. Oxydation E. Disproporsination
C. Reduction

12. In the reaction : PCl3 + Cl2 ----- PCl5

The spesi which catchs the electron is …..
A. PCl3 D.PCl3 and PCl5
B. Cl2 E. PCl3 and Cl2
C. PCl5
13.Which acts as oxydator in the reaction :
Ca + O2 --------- CaO is ….
A. Ca D. Ca2+ + 2e ----- Ca
B. O2 E. Ca ------ Ca2+ + 2e
C. CaO
14.Be observed from the hand over and acceptance electron reaction this is below which
is not belong to redox reaction is ….
A. Mg + Cl2 ------ MgCl2 D. 2Na +2H2O ---- 2NaOH + H2
B. 2Na + Cl2 ------ 2NaCl E. PCl3 + Cl2 ----- PCl5
C. 2Na + 2H2O ---- 2NaOH + H2
15. The oxydation’s number of S ( sulfur ) in pirosulfat acid compound ( H2S2O7 )
A. +4 D. +10
B. +6 E. +12
C. +8
Answer the Question briefly !

(1) A piece of iron, e.g. an iron nail, is dropped into a solution of copper sulphate. The nail gets
coated with copper metal. Write the reaction that takes place, and the redox equation. Which
atom has reduced, and which was oxidised.
answer

(2) Pure zinc metal is placed into dilute hydrochloric acid. Hydrogen gas H 2 is given off. Write
the general equation and the redox equation. Which atom has reduced, and which was oxidised.

answer

Answers
1. D 6.D 11.C
2. D 7.B 12.B
3.D 8.A 13.B
4.A 9.B 14.D
5.D 10.A 15.B

HYDROCARBON
Subject : Chemistry
Program : SBI
State : SMA 5 Surabaya
Class :X
 Semester : II
School Year : 2007/2008

1. Determine all types of isomers which can be happened or can be found from
hydrocarbon compounds (alkane, alkene, alkyne, alkadiene and cycloalkane) which
contain 5 carbon (C5), for each type of isomer, give 2 examples (compounds) and give
the name of each compound.
2. Draw the condensed formula for :
a. t-butil chloride
b. 3-isopropyl-2-heptene
c. 1,1-dichloro-3-methyl cyclohexane
d. hexa chloro ethane
3. Naming the compound !
a.

b. CF3CHClBr
c. (CH3)3CCHCH3
d. CH3CCCH(CH3)CH(CH3)2

FIRST TERM EXAMINATION TEST

SMA NEGERI 5 SURABAYA
ACADEMIC YEAR 2007/2008
Subject : Chemistry
 Class : X-1, X-2
Day/Date : Monday, January 8th 2007
Time : 10.00 -11.30
MULTIPLE CHOICE

1. A Bromide ion is composed of 36 electrons, 35 proton and 44 neutron. The ion is

represented by the symbol……
44 80 80 79 79
a. 35 Br - b. 36 Br + c. 35 Br - d. 35 Br - e. 36 Br -

2. The composition of two particle is given below :

Particle I 22 protons 22 neutrons 20 electrons
Particle II 21 protons 22 neutrons 20 electrons
The particles would best be described as…..
a. allotropes c. cations e. isobar
b. isotopes d. anions

3. An Atom , Z = 19 and A = 40 , position in periodic table is in……

a. group I b. group II c. group III d. group IV e. group V

4. An ionic bond is formed between two atom

a. by transfer of electrons from metallic to nonmetallic elements.
b. by sharing of electrons.
c. by changes in their nuclei.
d. whose difference in electronegativities is less than 1.7.
e. which are both nonmetals

5. Which of the following is an acceptable Lewis structure for CH3NH2?

(I) (II)

(III) (IV) (V)

a. IV b. I c. II d. V e. III

6. The element of the third period of periodic table are : Na Mg Al Si P S Cl Ar

The element with the lowest first ionization energy is….
a. Al b. Cl c. Na d. Ar e. P
7. Which of the following elements is the most electronegative ?
a. calsium b. Barium c. Potassium d. Magnesium e. Sodium

8. In which one of the following molecules does the covalent bond have the greatest
polarity, i.e. the greatest departure from equal sharing of electrons ?
a. HF b. NH3 c. CH4 d. H2O e. CO2
9. Which of the following is the correct Lewis structure for COCl2?

I II

III IV V

a. I b. III c. V d. II e. IV

10. Which one of the following molecules, the moment dipole is zero ?
a. HCl b. H2 c. NO d. ClF e. HF

11. Which one of the following molecules is non polar with polar bonding ?
a. H2 b.SO2 c. PCl3 d. H2O e. CCl4

12. Draw the Lewis formula for NF4+. How many lone pair(s) of electrons are there in the
valence shell of the central atom?
a. four b. three c. one d. zero e two

13. S is group VI A in periodic table. Consider the following molecules and select those
that are nonpolar.
1) SF2
2) SF4
3) SF6
a. 2 only b. 1 only c. 3 only d. 1 and 2 e. 1 and 3

14. The correct name for the formula of the following covalent compound is ….
a. SO2: sulfur dioxide
b. CO : carbon oxide
c. P2O5 : fosfor pentaoxide
d. N2O : dinitrogen oxide
e. Cl2O7 : dichlor hexaoxide

15. According to the Lavoisier’s Law, if a metal reacts with an oxygen gas, so the effect
is ….
a. there is an increasing mass
b. the volume of the oxygen gas decreases
c. the volume of both reactants are the same
d. the mass of the product is smaller than the mass of the reactants
e. before and after reaction, the mass of the substances are the same

16. From the daily life we know that carbon and oxygen can form 2 compounds, these are
carbon monoxide and carbon dioxide. Carbon monoxide contains 1,3321 g oxygen
for 1,0000 g carbon. Carbon dioxide consists of 2,6642 g oxygen for 1,0000 g carbon.
The correct statement about these data is ….
a. these two compounds prove the Dalton’s Law
b. the mass of oxygen in both compounds is the same
c. oxygen in the first compound prove the Proust’s Law
d. oxygen in the second compound prove the Lavoisier’s Law
e. oxygen in the first and second prove the Avogadro’s Law

17. The following table shows the data to prove the Proust’s Law :
Sample The mass of sample The mass of sodium The mass of oxygen
A 1,020 g 0,757 g 0,263 g
B 1,548 g 1,149 g 0,399 g
C 2,382 g 1,025 g 0,357 g
The correct conclusion which relates with the above data is ….
a. all samples have the same ratio
b. each sample has a certain ratio of the components
c. sample A has a different ratio with sample B
d. sample B has a different ratio with sample C
e. all samples follow the Proust’s Law

18. Aluminium (group IIIA) reacts rapidly with fluorine to form aluminium fluoride. The
correct answer of the balanced equation is ….
a. Al(s) + 3F(g)  AlF3(s)
b. Al(s) + F2(g)  AlF3(s)
c. 2Al(s) + 3F2(g)  2AlF3(s)
d. 3Al(s) + 3F3(g)  3AlF3(s)
e. Al2(s) + 3F2(g)  2AlF3(s)

19. Methane gas is burnt as a source of energy for cooking and heating. One molecule of
methane gas and 2 molecules of oxygen gas react to form 1 molecule of carbon
dioxide gas and 2 molecules of water. The correct equation is ….
a. CH4 + O2  CO2 + H2O
b. CH4 + 2O2  CO2 + 2H2O
c. CH4(g) + O2(g)  CO2(g) + H2O(g)
d. CH4(g) + 2O2(g)  CO2(g) + 2H2O(g)
e. CH4(g) + 2O2(g)  CO2(g) + 2H2O(l)
20. H2 (g) + Cl2 (g)  HCl (g)
If volume of HCl is 200 cm3. Volume of H2 (g) and Cl2 (g) in the reaction if measure in
the same temperature and pressure are….
a. 200 and 200 cm3
b. 300 and 300 cm3
c. 100 and 100 cm3
d. 150 and 150 cm3
e. 50 and 50 cm3

21. Nitric acid, HNO3 is a colorless, corrosive liquid used in the manufacture of nitrogen
fertilizers and explosives. In an experiment to develop new explosives for mining
operations, a 28,5 g sample of nitric acid was poured into a beaker. The number of
mole of HNO3 in the sample of nitric acid are ….( Ar H = 1; O = 16; N = 14)
a. 58.2/63
b. 82.5/63
c. 25.8/63
d. 28,5/63
e. 14.2/63

22. Hydrogen cyanide, HCN is a volatile, colorless liquid with the odor of certain fruit
pits. The compound is highly poisonous. The number of molecules in 54 mg HCN,
the everage toxic dose are …. ( Ar H = 1; C = 12; N =14)
a. 12.04 x 1020
b. 12.04 x 1021
c. 12.04 x 1023
d. 33.71 x 1020
e. 33.71 x 1023

23. Chlorophyll contains 2.72% magnesium by mass. Assuming one magnesium atom per
chlorophyll molecule, what is the molecular weight of chlorophyll?
(Atomic weight: Mg = 24.305).
a. 6.67 x 103
b. 66.7
c. 8.94 x 103
d. 8.94 x 102
e. 6.67 x 102

24. Determine the empirical formula of Teflon which is 24.0% C and 76.0% F.
(Atomic weights: C = 12.01, F = 19.00).
a. C2F b. CF3 c. CF2 d. C2F3 e. CF

25. The molecular formula of a compound which has an empirical formula of CH4N and
a molar mass of 60 g mol-1 is ….
a. CHN c. CH4N e. C2H8N2
b. CH2N d. C2H4N2
26. Methoxychlor, a garden insecticide, has the molecular formula C16H15Cl3O2. What is
the weight percent of chlorine?
(Atomic weights: C = 12.01, H = 1.008, Cl = 35.45, O = 16.00).
a. 30.8 b. 31.4 c. 29.2 d. 33.3 e. 32.5

27. Ammonium nitrate, NH4NO3 which is prepared from nitric acid, is used as a nitrogen
fertilizer. The mass percentages of an elements in ammonium nitrate are ….
a. 17.5%N, 10%H, 72.5%O
b. 35% N, 5% H, 60% O
c. 52.5% N, 5% H, 42.5% O
d. 60% N, 5% H, 35% O
e. 72.5% N, 5% H, 22.5% O

28. The mass of nitrogen in a fertilizer containing 40 g of ammonium nitrate is ….

a. 7 g b. 28 g c. 14 g d. 21 g e. 15 g

29. Aluminium chloride, AlCl3 is used as a catalyst in various industrial reactions. It is

prepared from hydrogen chloride gas and aluminium metal shavings.
2Al(s) + 6HCl(g)  2AlCl3(s) + 3H2(g)
Suppose a reaction vessel contains 0,15 mol Al and 0,35 mol HCl. The moles of AlCl3
which can be prepared from this mixture are ….
a. 0.15 b. 0.117 c. 0.176 d. 0.234 e.0.033

30. A solution of sodium carbonate is added to a solution of hydrochloric acid.the

reaction : Na2CO3(s) + 2 HCl(aq)  NaCl (aq) + CO2(g) + H2O(l) If the mass of
sodium carbonate is 1,06 grams (Mr = 106), the volume of the gas produced at STP is
….
a. 2.24 dm3 c. 1.12 dm3 e. 224 cm3
b. 22.4 dm3 d. 112 cm3

ESSAY
31. Iron and cobalt are adjacent element in the periodic table. Iron has three main
naturally occuring isotopes, cobalt has one.
a. Explain the meaning of the term isotope
56 59
b. Complete the table below to show the atomic structure of 26 Fe, 27 Co
Number of
isotope protons neutrons electron
56
26 Fe
59
27 Co
c. A sample of iron has the following isotopic composition by mass

Isotope mass 54 56 57
% by mass 5.84 91.68 2.17

By using data above, calculate the relative atomic mass of iron.

32. The diagram shows part of periodic table

Li C N O F
Na S Cl
K Fe Cu Zn Br
Answer the question using only the elements shown in diagram. Write down the symbol
for an element which :
a. transition metal
b. forms an basidic oxide
c. has six electrons in its outer shell
d. has smallest electronegativity, the biggest afinity, and the largest ionisation energy
?

33. Magnesium is the eight most common element in the Earth’s crust. Metal is widely
used in alloy which are light and strong. Some reactions of magnesium and its
compounds are shown in the reaction scheme below :

Identify the name and the formula, compound A to F.

34. Benzoic acid is a white, crystalline powder used as a food preservative. The
compound contains 68,8% C, 5,0% H, and 26,2% O, by mass. Ar C = 12; H = 1; O = 16.
a. What is its empirical formula?
b. If the molecule mass relative of benzoic acid is 122, determine its molecular formula!

35. Calcium carbonate solid is added to a solution of hydro chloric acid. The molarity of
acid is 2,0 M and the mass of calcium carbonate is 20 grams. The atomic mass relative of
Ca = 40; C = 12; O = 16; H = 1; Cl = 35,5.
a. Write down the balanced equation.
b. Calculate the number of mole of calcium carbonate solid.
c. At least, how many dm3 of acid which are needed for this reaction?
d. Determine the volume of gas produced in this reaction at STP.

SECOND TERM EXAMINATION TEST

SMA NEGERI 5 SURABAYA
ACADEMIC YEAR 2007/ 2008
Subject : Chemistry
Class :X
Day/ Date :
Time : 07.00 – 08.30
MULTIPLE CHOICE
Intruction : Choose A, B, C, D or E which shows the correct answer!

1. You encounter many organic compounds every day. Some organic compounds are
ethanol (grain alcohol), ethylene glycol (automobile antifreeze), and acetone (nail
polish remover). Another organic compound which can be found in the daily life is
….
a. salt
b. water
c. sugar
d. bone
e. mineral
2. The special features of carbon below are correct, except ….
a.has tetravalence
b. forms covalence of four
c.can bond one of another
d. the atomic number is 6
e.makes possible branched chains
3. The statements below are correct about carbon atom, except ….
a.group IVA in the periodic table
b. can forms single covalent bonds
c.its compounds are molecules
d. is contained in the diamond
e.has 6 electrons’ valence
4. The simplest organic compounds are hydrocarbons, compounds containing only
carbon and hydrogen. The wrong hydrocarbon compounds is ….
a.butane
b. alcohol
c.benzene
d. isoprene
e.cyclopropane
5. All other organic compounds are considered for classification purposes to be derived
from hydrocarbons. The following are the examples of other organic compounds,
except ….
a.carbohydratate
b. proteine
c.petroleum
d. cholesterol
e.oil
6. Hydrocarbons are classified into two main types, aliphatic and aromatic. The
following substances which can not be classified as an aliphatic hydrocarbon is ….
a.alkane
b. alkene
c.alkyne
d. benzene
e.cycloalkane
7. Methane is the simplest hydrocarbon. The wrong statement about methane is ….

a. has four C—H bonds

b. each engle of HCH is109,5°
c. there are 8 electron’s pairs
d. forms a tetrahedral structure
e. four hydrogen atoms are bonded

8. To look at the three-dimensional arrangement of atoms in the hydrocarbon

compounds, you would draw a three-dimensional formula by ….
a.make a diagram
b. make a picture
c.make a three-dimensional picture
d. construct a model of the atoms
e.construct a model of the molecule
9. A hydrocarbon in which all carbon atoms are bonded to the maximum number of
hydrogen atoms is classified as … hydrocarbon
a.saturated
b. aromatic
c.alkene
d. alkyne
e.cyclic
10. The following statements are correct about the alkanes, except ….
a.also called paraffins
b. unsaturated hydrocarbons
c.the general formula is CnH2n+2
d. for n = 3, the molecular formula is C3H8
H H
e.the structural formula of the second alkane is H-C-C-H
H H

11. A homologous series of alkanes is a series of alkane compounds in which one

compound differs from a preceding one by ….
a.–CH–
b. –CH2–
c.–CH3
d. –CnH2n–
e.–CnH2n+1–
12. Butane and isobutane are structural isomers, compounds with the same molecular
formula but different structural formulas. Because these isomers have different
structures, they have different ….
 a.mass
b. volume
c.boiling point
d. molecular mass relative
e.mass’ percentage of elements
13. The condensed structural formula of 4-ethyl-3-methylheptane is ….
a.CH3CH2CH(CH3)CH(CH2CH3)(CH2)2CH3
b. CH3CH2CH(CH3)CH(CH2CH3)(CH2)2CH3
c.CH3CH2CH(CH3)CH(CH2CH3)(CH2)2CH3
d. CH3CH2CH(CH3)CH(CH2CH3)(CH2)2CH3
e.CH3CH2CH(CH3)CH(CH2CH3)(CH2)2CH3
14. The IUPAC name of CH3CH2C(CH3)2(CH2)4CH3 is ….
a.3-methyloctane
b. 3-dimethyloctane
c.3,3-dimethyloctane
d. 3-dimethylheptane
e.3,4-dimethyloctane
15. Cycloalkanes are saturated hydrocarbons in which the carbon atoms form a ring; the
general formula is ….
a.CnHn-2
b. CnHn
c.CnH2n-2
d. CnH2n
e.CnH2n+2
16. The following compounds are alkenes, except ….
a.CH2C(CH3)CH(CH3)2
b. CH3(CH)2CH3
c.C(CH3)3C(CH3)CH2
d. C2H5(CH)2CH3
e.C(CH3)4
17. 2-methyl-1-butene is the positional isomer of ….
a.1-butene
b. 2-butene
c.1-pentene
d. 2-methyl-2-butene
e.3-methyl-1-butene
18. The following compounds which can form a geometrical isomer is ....
a.1-butene
b. 2-butene
c. 2-pentene
d. 2-methyl-1-butene
e.3-methyl-1-butene
19. Alkanes are saturated hydrocarbons and therefore, are generally ….
a. reactive
b. unreactive
c. quite reactive
 d. more reactive than alkenes
e. less reactive than alkenes
20. Alkanes are non-polar and so, are unreactive towards ….
a. non-polar reagens
b. ionic reagents
c. oxygen
d. halogens
e. hydrogen halides
21. All hydrocarbons burn easily in an excess oxygens to form carbon dioxide and water.
This reaction is classified as ….
a. redox
b. reduction
c. incomplete burning
d. complete combustion
e. incomplete combustion
22. The large negative ∆H’s explain why hydrocarbons are useful as fuels. The following
properties that unrelated to the above information is ….
a. endothermic
b. release energy
c. can produce fire
d. react with oxygen
e. easily to be burned
23. The correct chemical equation of complete combustion in general is ….
a. CxHy + O2  CO + H2O
b. CxHy + O2  CO2 + H2O
c. CxHy + O2  x CO2 + y/2 H2O
d. CxHy + (x+y) O2  x CO + y H2O
e. CxHy + (x+y/4) O2  x CO2 + y/2 H2O
24. Hydrocarbons only burn in the gaseous state. The meaning of this statement is ….
a. solid hydrocarbons can not be burned
b. liquid hydrocarbons are difficult to be burned
c. in the gaseous state, the number of molecules decrease
d. each molecule of hydrocarbons gas is far one of another
e. the molecule is easily reacting, because its mass decreases
25. The following statements which correct about burning hydrocarbons is ….
a. less volatile hydrocarbons burn less readily
b. solid hydrocarbons must be vaporized before burning
c. CO and C are also formed in an incomplete combustion
d. for completing combustion, an excess oxygen is needed
e. when hydrocarbons burn in a limited oxygen, still produce CO2
26. The reaction of alkanes with halogens is called ….
a. addition
b. substitution
c. oxidation
d. combustion
e. hydrogenation
27. All of the H atoms of an alkane may undergo substitution, leading to a mixture of
products. The correct answer is ….
a. bromine is the most reactive reagent
b. chlorine is more reactive than fluorine
c. bromine is more reactive than chlorine
d. fluorine is very reactive, usually gives complete substitution
e. chlorine is less reactive than bromine, often requires elevated temperatures
28. Alkenes are more reactive than alkanes because of the presence of ….
a. the single bond
b. the double bond
c. the triple bond
d. the carbon atoms
e. the hydrogen atoms
29. An addition reaction is a reaction in which parts of a reactant are added to each
carbon atom of a carbon–carbon double bond, which then ….
a. has enough carbon atoms
b. the length of the chain increases
c. the atoms of hydrogen increase
d. becomes a carbon–carbon single bond
e. the number of carbon-carbon double bond decrease
30. Addition to triple bonds is also possible, giving a product with ….
a. a single bond
b. a single bond and a double bond
c. a single bond, if there is an excess reactant
d. a double bond, if there is an excess reactant
e. a triple bond, if there is not enough reactant
31. The addition of Br2 to an alkene occurs so readily that bromine dissolved in carbon
tetrachloride, CCl4. It is a useful reagent to test for unsaturation. When a few drops of
the solution are added to an alkene, so ….
a. the bromine immediately react
b. the color of bromine changes
c. the reaction occurs suddently
d. the redbrown color of the bromine changes
e. the redbrown color of the bromine is immediately lost
32. The following statements are correct about an addition reaction, except ….
a. HCl and HBr are unsymmetrical reagents
b. 1-butene is an unsymmetrical alkene
c. two products that are isomers will occurred in equal amounts
d. the H atom of HBr adds to C atom 1, giving 2-bromopropane
e. the H atom of HBr adds to C atom 2, giving 1-bromopropane
33. The correct statement about the Markownikoff’s rule is ….
a. the rich gets richer
b. there is only one product formed
c. HBr is a symmetrical reagents
d. H2O could not be added to alkenes
e. H atom of HCl attacts C atom of C = C
34. The main product when HBr adds to 1-butene is ….
a. 2-butene
b. n-butane
c. 1-bromobutene
d. 1-bromobutane
e. 2-bromobutane
35. The alkynes also undergo addition reactions, usually adding … molecule(s) of the
reagent for each C ≡ C bond.
a. 1
b. 2
c. 3
d. 4
e. 5
36. Natural gas is mainly … with smaller amounts of the other gaseous alkanes.
a. methane
b. ethane
c. propane
d. butane
e. pentane
37. Petroleum is a mixture of … with smaller amounts of aromatic hydrocarbons.
a. alkanes and alkenes
b. alkanes and cycloalkanes
c. alkenes and cycloalkanes
d. alkynes and alkenes
e. alkynes and alkanes
38. Petroleum is separated by distillation into fractions such as gasoline and kerosene.
These fractions are usually processed further—for example, to obtain a greater
quantity of gasoline with the desired fuel characteristics. This processing is called ….
a. refining
b. solubility
c. filtration
d. evaporation
e. coagulation
39. The following hydrocarbons are used as a fuel, except ….
a. LNG
b. LPG
c. kerosine
d. gasoline
e. vaseline
40. For a gasoline to function properly in an engine, it should not begin to burn before it
is ignited by the spark plug. If it does, it gives engine “knock.” The wrong statement
below is ….
a. this scale is based on heptane and isooctane
b. an octane number of heptane is the same with isooctane
c. 2,2,4-trimethylpentane (isooctane), its octane number is 100
d. the higher the octane number, the better are the antiknock characteristics
e. the antiknock characteristics of a gasoline are rated by the octane-number scale